C23H17ClN6 — CID 171493895
3-[3-[4-(chloromethyl)phenyl]-5-pyridin-3-ylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 171493895) has the molecular formula C23H17ClN6 and a molecular weight of 412.88 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)phenyl]-5-pyridin-3-ylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-(chloromethyl)phenyl]-5-pyridin-3-ylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171493895 |
| Molecular Formula | C23H17ClN6 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-[3-[4-(chloromethyl)phenyl]-5-pyridin-3-ylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1nc2ccc(-c3cccnc3)nc2n1-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C23H17ClN6/c24-13-15-5-7-17(8-6-15)30-22(18-4-2-12-27-21(18)25)29-20-10-9-19(28-23(20)30)16-3-1-11-26-14-16/h1-12,14H,13H2,(H2,25,27) |
| InChIKey | HULHUQBYDKTPTC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|