C28H23ClN6O — CID 171599241
1-[3-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]phenyl]pyrrolidin-2-one (PubChem CID 171599241) has the molecular formula C28H23ClN6O and a molecular weight of 494.99 g/mol. Its IUPAC name is 1-[3-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171599241 |
| Molecular Formula | C28H23ClN6O |
| Molecular Weight | 494.99 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 1-[3-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]phenyl]pyrrolidin-2-one |
| SMILES | Nc1ncccc1-c1nc2ccc(-c3cccc(N4CCCC4=O)c3)nc2n1-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C28H23ClN6O/c29-17-18-8-10-20(11-9-18)35-27(22-6-2-14-31-26(22)30)33-24-13-12-23(32-28(24)35)19-4-1-5-21(16-19)34-15-3-7-25(34)36/h1-2,4-6,8-14,16H,3,7,15,17H2,(H2,30,31) |
| InChIKey | IMILGZWTUCUZPV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|