C24H16ClN7 — CID 171494572
5-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]pyridine-2-carbonitrile (PubChem CID 171494572) has the molecular formula C24H16ClN7 and a molecular weight of 437.89 g/mol. Its IUPAC name is 5-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171494572 |
| Molecular Formula | C24H16ClN7 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 5-[2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]imidazo[4,5-b]pyridin-5-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc3nc(-c4cccnc4N)n(-c4ccc(CCl)cc4)c3n2)cn1 |
| InChI | InChI=1S/C24H16ClN7/c25-12-15-3-7-18(8-4-15)32-23(19-2-1-11-28-22(19)27)31-21-10-9-20(30-24(21)32)16-5-6-17(13-26)29-14-16/h1-11,14H,12H2,(H2,27,28) |
| InChIKey | JLCMUDAZBJYOGT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|