C29H28N8 — CID 171625744
cyanamide;3-[5-phenyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 171625744) has the molecular formula C29H28N8 and a molecular weight of 488.60 g/mol. Its IUPAC name is cyanamide;3-[5-phenyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | cyanamide;3-[5-phenyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171625744 |
| Molecular Formula | C29H28N8 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | cyanamide;3-[5-phenyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | N#CN.Nc1ncccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C28H26N6.CH2N2/c29-26-23(9-6-16-30-26)27-32-25-15-14-24(21-7-2-1-3-8-21)31-28(25)34(27)22-12-10-20(11-13-22)19-33-17-4-5-18-33;2-1-3/h1-3,6-16H,4-5,17-19H2,(H2,29,30);2H2 |
| InChIKey | IMKGJLYVWIQUMT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|