C34H40N8 — CID 171625663
4-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-2-methylpiperazine-1-carbonitrile;ethane (PubChem CID 171625663) has the molecular formula C34H40N8 and a molecular weight of 560.75 g/mol. Its IUPAC name is 4-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-2-methylpiperazine-1-carbonitrile;ethane.
| Compound Name | 4-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-2-methylpiperazine-1-carbonitrile;ethane |
|---|---|
| PubChem CID | 171625663 |
| Molecular Formula | C34H40N8 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 4-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-2-methylpiperazine-1-carbonitrile;ethane |
| SMILES | CC.CC.CC1CN(Cc2ccc(-n3c(-c4cccnc4N)nc4ccc(-c5ccccc5)nc43)cc2)CCN1C#N |
| InChI | InChI=1S/C30H28N8.2C2H6/c1-21-18-36(16-17-37(21)20-31)19-22-9-11-24(12-10-22)38-29(25-8-5-15-33-28(25)32)35-27-14-13-26(34-30(27)38)23-6-3-2-4-7-23;2*1-2/h2-15,21H,16-19H2,1H3,(H2,32,33);2*1-2H3 |
| InChIKey | WOUUITCDPPLDRK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|