C31H30N8 — CID 171625759
[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]cyanamide (PubChem CID 171625759) has the molecular formula C31H30N8 and a molecular weight of 514.64 g/mol. Its IUPAC name is [1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]cyanamide.
| Compound Name | [1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]cyanamide |
|---|---|
| PubChem CID | 171625759 |
| Molecular Formula | C31H30N8 |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | [1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]cyanamide |
| SMILES | N#CNC1CCCCN(Cc2ccc(-n3c(-c4cccnc4N)nc4ccc(-c5ccccc5)nc43)cc2)C1 |
| InChI | InChI=1S/C31H30N8/c32-21-35-24-9-4-5-18-38(20-24)19-22-11-13-25(14-12-22)39-30(26-10-6-17-34-29(26)33)37-28-16-15-27(36-31(28)39)23-7-2-1-3-8-23/h1-3,6-8,10-17,24,35H,4-5,9,18-20H2,(H2,33,34) |
| InChIKey | LHKLLHRXWHBDCD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|