C38H35N7O3 — CID 171103411
N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]-4-formyl-3-hydroxybenzamide (PubChem CID 171103411) has the molecular formula C38H35N7O3 and a molecular weight of 637.74 g/mol. Its IUPAC name is N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]-4-formyl-3-hydroxybenzamide.
| Compound Name | N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]-4-formyl-3-hydroxybenzamide |
|---|---|
| PubChem CID | 171103411 |
| Molecular Formula | C38H35N7O3 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | N-[1-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]azepan-3-yl]-4-formyl-3-hydroxybenzamide |
| SMILES | Nc1ncccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccc(CN2CCCCC(NC(=O)c3ccc(C=O)c(O)c3)C2)cc1 |
| InChI | InChI=1S/C38H35N7O3/c39-35-31(10-6-19-40-35)36-43-33-18-17-32(26-7-2-1-3-8-26)42-37(33)45(36)30-15-11-25(12-16-30)22-44-20-5-4-9-29(23-44)41-38(48)27-13-14-28(24-46)34(47)21-27/h1-3,6-8,10-19,21,24,29,47H,4-5,9,20,22-23H2,(H2,39,40)(H,41,48) |
| InChIKey | CACHGLOHYVFXPU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|