C41H45N7O2 — CID 171103029
5-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-hydroxybenzaldehyde;ethane (PubChem CID 171103029) has the molecular formula C41H45N7O2 and a molecular weight of 667.86 g/mol. Its IUPAC name is 5-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-hydroxybenzaldehyde;ethane.
| Compound Name | 5-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-hydroxybenzaldehyde;ethane |
|---|---|
| PubChem CID | 171103029 |
| Molecular Formula | C41H45N7O2 |
| Molecular Weight | 667.86 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | 5-[2-[[4-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-hydroxybenzaldehyde;ethane |
| SMILES | CC.CC.Nc1ncccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccc(CN2CC3CN(c4ccc(O)c(C=O)c4)CC3C2)cc1 |
| InChI | InChI=1S/C37H33N7O2.2C2H6/c38-35-31(7-4-16-39-35)36-41-33-14-13-32(25-5-2-1-3-6-25)40-37(33)44(36)29-10-8-24(9-11-29)18-42-19-27-21-43(22-28(27)20-42)30-12-15-34(46)26(17-30)23-45;2*1-2/h1-17,23,27-28,46H,18-22H2,(H2,38,39);2*1-2H3 |
| InChIKey | JMYWKQYDJPCVHL-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.86 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|