C25H17ClN6 — CID 171599525
3-[3-[4-(chloromethyl)phenyl]-5-(3-isocyanophenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 171599525) has the molecular formula C25H17ClN6 and a molecular weight of 436.91 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)phenyl]-5-(3-isocyanophenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-(chloromethyl)phenyl]-5-(3-isocyanophenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171599525 |
| Molecular Formula | C25H17ClN6 |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-[3-[4-(chloromethyl)phenyl]-5-(3-isocyanophenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3nc(-c4cccnc4N)n(-c4ccc(CCl)cc4)c3n2)c1 |
| InChI | InChI=1S/C25H17ClN6/c1-28-18-5-2-4-17(14-18)21-11-12-22-25(30-21)32(19-9-7-16(15-26)8-10-19)24(31-22)20-6-3-13-29-23(20)27/h2-14H,15H2,(H2,27,29) |
| InChIKey | FSLADPGVCOWBID-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|