C24H17N7O — CID 171599493
[4-[2-(2-amino-3-pyridinyl)-5-(5-isocyano-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol (PubChem CID 171599493) has the molecular formula C24H17N7O and a molecular weight of 419.45 g/mol. Its IUPAC name is [4-[2-(2-amino-3-pyridinyl)-5-(5-isocyano-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol.
| Compound Name | [4-[2-(2-amino-3-pyridinyl)-5-(5-isocyano-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 171599493 |
| Molecular Formula | C24H17N7O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [4-[2-(2-amino-3-pyridinyl)-5-(5-isocyano-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol |
| SMILES | [C-]#[N+]c1cncc(-c2ccc3nc(-c4cccnc4N)n(-c4ccc(CO)cc4)c3n2)c1 |
| InChI | InChI=1S/C24H17N7O/c1-26-17-11-16(12-27-13-17)20-8-9-21-24(29-20)31(18-6-4-15(14-32)5-7-18)23(30-21)19-3-2-10-28-22(19)25/h2-13,32H,14H2,(H2,25,28) |
| InChIKey | BHTXTIRCAPYBIA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|