C26H23ClN6 — CID 177317072
3-[3-[4-(chloromethyl)phenyl]-5-(5-propan-2-yl-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 177317072) has the molecular formula C26H23ClN6 and a molecular weight of 454.97 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)phenyl]-5-(5-propan-2-yl-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-(chloromethyl)phenyl]-5-(5-propan-2-yl-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 177317072 |
| Molecular Formula | C26H23ClN6 |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-[3-[4-(chloromethyl)phenyl]-5-(5-propan-2-yl-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | CC(C)c1ccc(-c2ccc3nc(-c4cccnc4N)n(-c4ccc(CCl)cc4)c3n2)nc1 |
| InChI | InChI=1S/C26H23ClN6/c1-16(2)18-7-10-21(30-15-18)22-11-12-23-26(31-22)33(19-8-5-17(14-27)6-9-19)25(32-23)20-4-3-13-29-24(20)28/h3-13,15-16H,14H2,1-2H3,(H2,28,29) |
| InChIKey | MDSWVKINDKRCTI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|