C23H16ClF2N7O — CID 177316904
3-[3-[4-(chloromethyl)phenyl]-5-[5-(difluoromethoxy)pyrazin-2-yl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 177316904) has the molecular formula C23H16ClF2N7O and a molecular weight of 479.88 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)phenyl]-5-[5-(difluoromethoxy)pyrazin-2-yl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-(chloromethyl)phenyl]-5-[5-(difluoromethoxy)pyrazin-2-yl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 177316904 |
| Molecular Formula | C23H16ClF2N7O |
| Molecular Weight | 479.88 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 3-[3-[4-(chloromethyl)phenyl]-5-[5-(difluoromethoxy)pyrazin-2-yl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1nc2ccc(-c3cnc(OC(F)F)cn3)nc2n1-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C23H16ClF2N7O/c24-10-13-3-5-14(6-4-13)33-21(15-2-1-9-28-20(15)27)32-17-8-7-16(31-22(17)33)18-11-30-19(12-29-18)34-23(25)26/h1-9,11-12,23H,10H2,(H2,27,28) |
| InChIKey | JFTFORUGYSLDHS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.88 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|