C21H17ClN8 — CID 171496157
3-[3-[4-(chloromethyl)phenyl]-5-(4-methyl-1,2,4-triazol-3-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 171496157) has the molecular formula C21H17ClN8 and a molecular weight of 416.88 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)phenyl]-5-(4-methyl-1,2,4-triazol-3-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-(chloromethyl)phenyl]-5-(4-methyl-1,2,4-triazol-3-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171496157 |
| Molecular Formula | C21H17ClN8 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-[3-[4-(chloromethyl)phenyl]-5-(4-methyl-1,2,4-triazol-3-yl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | Cn1cnnc1-c1ccc2nc(-c3cccnc3N)n(-c3ccc(CCl)cc3)c2n1 |
| InChI | InChI=1S/C21H17ClN8/c1-29-12-25-28-21(29)17-9-8-16-20(27-17)30(14-6-4-13(11-22)5-7-14)19(26-16)15-3-2-10-24-18(15)23/h2-10,12H,11H2,1H3,(H2,23,24) |
| InChIKey | GXSXWRHCCVDBBG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|