C25H30N4OSi — CID 177316408
3-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrrolo[3,2-c]pyridin-2-yl]pyridin-2-amine (PubChem CID 177316408) has the molecular formula C25H30N4OSi and a molecular weight of 430.63 g/mol. Its IUPAC name is 3-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrrolo[3,2-c]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrrolo[3,2-c]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 177316408 |
| Molecular Formula | C25H30N4OSi |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrrolo[3,2-c]pyridin-2-yl]pyridin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(-n2c(-c3cccnc3N)cc3cnccc32)cc1 |
| InChI | InChI=1S/C25H30N4OSi/c1-25(2,3)31(4,5)30-17-18-8-10-20(11-9-18)29-22-12-14-27-16-19(22)15-23(29)21-7-6-13-28-24(21)26/h6-16H,17H2,1-5H3,(H2,26,28) |
| InChIKey | XVIXKIUXYZKMBH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|