C22H17N5O2 — CID 171599439
[4-[2-(2-amino-3-pyridinyl)-5-isocyanobenzimidazol-1-yl]phenyl]methyl acetate (PubChem CID 171599439) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is [4-[2-(2-amino-3-pyridinyl)-5-isocyanobenzimidazol-1-yl]phenyl]methyl acetate.
| Compound Name | [4-[2-(2-amino-3-pyridinyl)-5-isocyanobenzimidazol-1-yl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 171599439 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | [4-[2-(2-amino-3-pyridinyl)-5-isocyanobenzimidazol-1-yl]phenyl]methyl acetate |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(-c1cccnc1N)n2-c1ccc(COC(C)=O)cc1 |
| InChI | InChI=1S/C22H17N5O2/c1-14(28)29-13-15-5-8-17(9-6-15)27-20-10-7-16(24-2)12-19(20)26-22(27)18-4-3-11-25-21(18)23/h3-12H,13H2,1H3,(H2,23,25) |
| InChIKey | LWHYBZZXEFJJEH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|