C20H33N3OSi — CID 58532546
3-tert-butyl-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrazol-5-amine (PubChem CID 58532546) has the molecular formula C20H33N3OSi and a molecular weight of 359.59 g/mol. Its IUPAC name is 3-tert-butyl-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrazol-5-amine.
| Compound Name | 3-tert-butyl-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 58532546 |
| Molecular Formula | C20H33N3OSi |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 3-tert-butyl-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]pyrazol-5-amine |
| SMILES | CC(C)(C)c1cc(N)n(-c2ccc(CO[Si](C)(C)C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C20H33N3OSi/c1-19(2,3)17-13-18(21)23(22-17)16-11-9-15(10-12-16)14-24-25(7,8)20(4,5)6/h9-13H,14,21H2,1-8H3 |
| InChIKey | WKYYYFIJGMOIOL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|