C14H18N3O2S- — CID 174608664
[4-(5-amino-3-tert-butylpyrazol-1-yl)phenyl]methanesulfinate (PubChem CID 174608664) has the molecular formula C14H18N3O2S- and a molecular weight of 292.38 g/mol. Its IUPAC name is [4-(5-amino-3-tert-butylpyrazol-1-yl)phenyl]methanesulfinate.
| Compound Name | [4-(5-amino-3-tert-butylpyrazol-1-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174608664 |
| Molecular Formula | C14H18N3O2S- |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [4-(5-amino-3-tert-butylpyrazol-1-yl)phenyl]methanesulfinate |
| SMILES | CC(C)(C)c1cc(N)n(-c2ccc(CS(=O)[O-])cc2)n1 |
| InChI | InChI=1S/C14H19N3O2S/c1-14(2,3)12-8-13(15)17(16-12)11-6-4-10(5-7-11)9-20(18)19/h4-8H,9,15H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | IJOFEWGBPVHQAO-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|