C12H13N3O4 — CID 104717412
3-(3-cyano-2-nitroanilino)pentanoic acid (PubChem CID 104717412) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-(3-cyano-2-nitroanilino)pentanoic acid.
| Compound Name | 3-(3-cyano-2-nitroanilino)pentanoic acid |
|---|---|
| PubChem CID | 104717412 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-(3-cyano-2-nitroanilino)pentanoic acid |
| SMILES | CCC(CC(=O)O)Nc1cccc(C#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O4/c1-2-9(6-11(16)17)14-10-5-3-4-8(7-13)12(10)15(18)19/h3-5,9,14H,2,6H2,1H3,(H,16,17) |
| InChIKey | WWNBKQXZAAFQKQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|