C15H20N2O2 — CID 113496799
3-(2-cyanoanilino)-5,5-dimethylhexanoic acid (PubChem CID 113496799) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(2-cyanoanilino)-5,5-dimethylhexanoic acid.
| Compound Name | 3-(2-cyanoanilino)-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 113496799 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-(2-cyanoanilino)-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CC(CC(=O)O)Nc1ccccc1C#N |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,3)9-12(8-14(18)19)17-13-7-5-4-6-11(13)10-16/h4-7,12,17H,8-9H2,1-3H3,(H,18,19) |
| InChIKey | PAPPFTSQIJIYPY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |