C15H15ClN4O — CID 104719697
2-(1-chloroethyl)-1-(6-oxopiperidin-3-yl)benzimidazole-4-carbonitrile (PubChem CID 104719697) has the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(6-oxopiperidin-3-yl)benzimidazole-4-carbonitrile.
| Compound Name | 2-(1-chloroethyl)-1-(6-oxopiperidin-3-yl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104719697 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(1-chloroethyl)-1-(6-oxopiperidin-3-yl)benzimidazole-4-carbonitrile |
| SMILES | CC(Cl)c1nc2c(C#N)cccc2n1C1CCC(=O)NC1 |
| InChI | InChI=1S/C15H15ClN4O/c1-9(16)15-19-14-10(7-17)3-2-4-12(14)20(15)11-5-6-13(21)18-8-11/h2-4,9,11H,5-6,8H2,1H3,(H,18,21) |
| InChIKey | WPDTYPLQRWVKGR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|