C21H24N4 — CID 10471976
3,5-diphenyl-1-(2-pyrrolidin-1-ylethyl)pyrazol-4-amine (PubChem CID 10471976) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 3,5-diphenyl-1-(2-pyrrolidin-1-ylethyl)pyrazol-4-amine.
| Compound Name | 3,5-diphenyl-1-(2-pyrrolidin-1-ylethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 10471976 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3,5-diphenyl-1-(2-pyrrolidin-1-ylethyl)pyrazol-4-amine |
| SMILES | Nc1c(-c2ccccc2)nn(CCN2CCCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H24N4/c22-19-20(17-9-3-1-4-10-17)23-25(16-15-24-13-7-8-14-24)21(19)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16,22H2 |
| InChIKey | QRYZDLWSAPRDNN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |