C20H29N3S — CID 95142744
1-[2-[5-[(2R)-2-methylsulfanylpropyl]-4-phenylimidazol-1-yl]ethyl]piperidine (PubChem CID 95142744) has the molecular formula C20H29N3S and a molecular weight of 343.54 g/mol. Its IUPAC name is 1-[2-[5-[(2R)-2-methylsulfanylpropyl]-4-phenylimidazol-1-yl]ethyl]piperidine.
| Compound Name | 1-[2-[5-[(2R)-2-methylsulfanylpropyl]-4-phenylimidazol-1-yl]ethyl]piperidine |
|---|---|
| PubChem CID | 95142744 |
| Molecular Formula | C20H29N3S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[2-[5-[(2R)-2-methylsulfanylpropyl]-4-phenylimidazol-1-yl]ethyl]piperidine |
| SMILES | CS[C@H](C)Cc1c(-c2ccccc2)ncn1CCN1CCCCC1 |
| InChI | InChI=1S/C20H29N3S/c1-17(24-2)15-19-20(18-9-5-3-6-10-18)21-16-23(19)14-13-22-11-7-4-8-12-22/h3,5-6,9-10,16-17H,4,7-8,11-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | OGVFRNHBPHRUPV-QGZVFWFLSA-N |
| XLogP | 4.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |