C15H23NS — CID 21391076
1-(3-phenylsulfanylbutyl)piperidine (PubChem CID 21391076) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-(3-phenylsulfanylbutyl)piperidine.
| Compound Name | 1-(3-phenylsulfanylbutyl)piperidine |
|---|---|
| PubChem CID | 21391076 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-(3-phenylsulfanylbutyl)piperidine |
| SMILES | CC(CCN1CCCCC1)Sc1ccccc1 |
| InChI | InChI=1S/C15H23NS/c1-14(17-15-8-4-2-5-9-15)10-13-16-11-6-3-7-12-16/h2,4-5,8-9,14H,3,6-7,10-13H2,1H3 |
| InChIKey | FXYDXIUOKBYALZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |