4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid

C15H13Cl2NO2 — CID 104726007

IUPAC4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid
SMILESCc1cc(Cl)c(NCc2ccc(C(=O)O)cc2)cc1Cl
InChIInChI=1S/C15H13Cl2NO2/c1-9-6-13(17)14(7-12(9)16)18-8-10-2-4-11(5-3-10)15(19)20/h2-7,18H,8H2,1H3,(H,19,20)
InChIKeySOEDQZPSCUWKKT-UHFFFAOYSA-N
MW310.18 g/mol
LogP4.61
Rot. Bonds4

About 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid

4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid (PubChem CID 104726007) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid.

Molecular Properties

Compound Name4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid
PubChem CID104726007
Molecular FormulaC15H13Cl2NO2
Molecular Weight310.18 g/mol
Exact Mass309.03
IUPAC Name4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid
SMILESCc1cc(Cl)c(NCc2ccc(C(=O)O)cc2)cc1Cl
InChIInChI=1S/C15H13Cl2NO2/c1-9-6-13(17)14(7-12(9)16)18-8-10-2-4-11(5-3-10)15(19)20/h2-7,18H,8H2,1H3,(H,19,20)
InChIKeySOEDQZPSCUWKKT-UHFFFAOYSA-N
XLogP4.61
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.18
LogP ≤ 54.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid?
The IUPAC name of 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid (CID 104726007) is 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid.
What is the SMILES notation for 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid?
The canonical SMILES for 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid is Cc1cc(Cl)c(NCc2ccc(C(=O)O)cc2)cc1Cl.
What is the InChIKey of 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid?
The InChIKey is SOEDQZPSCUWKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO2/c1-9-6-13(17)14(7-12(9)16)18-8-10-2-4-11(5-3-10)15(19)20/h2-7,18H,8H2,1H3,(H,19,20).
What are the key properties of 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid?
4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid has a molecular weight of 310.18 g/mol, XLogP of 4.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dichloro-4-methylanilino)methyl]benzoic acid is sourced from PubChem (CID 104726007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).