C14H10Cl3N3 — CID 104727625
2-(chloromethyl)-1-(2,5-dichloro-4-methylphenyl)imidazo[4,5-c]pyridine (PubChem CID 104727625) has the molecular formula C14H10Cl3N3 and a molecular weight of 326.61 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,5-dichloro-4-methylphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(chloromethyl)-1-(2,5-dichloro-4-methylphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 104727625 |
| Molecular Formula | C14H10Cl3N3 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-(chloromethyl)-1-(2,5-dichloro-4-methylphenyl)imidazo[4,5-c]pyridine |
| SMILES | Cc1cc(Cl)c(-n2c(CCl)nc3cnccc32)cc1Cl |
| InChI | InChI=1S/C14H10Cl3N3/c1-8-4-10(17)13(5-9(8)16)20-12-2-3-18-7-11(12)19-14(20)6-15/h2-5,7H,6H2,1H3 |
| InChIKey | MFMVCJJGHQZSHQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|