C15H15ClN4 — CID 115378883
3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline (PubChem CID 115378883) has the molecular formula C15H15ClN4 and a molecular weight of 286.77 g/mol. Its IUPAC name is 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline.
| Compound Name | 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115378883 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-n2c(CCl)nc3cnccc32)c1 |
| InChI | InChI=1S/C15H15ClN4/c1-19(2)11-4-3-5-12(8-11)20-14-6-7-17-10-13(14)18-15(20)9-16/h3-8,10H,9H2,1-2H3 |
| InChIKey | HDBFAMQURCDGFF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|