C20H18N4O2 — CID 10472803
1-benzyl-3-(cyclopropylmethyl)purino[7,8-a]pyridine-2,4-dione (PubChem CID 10472803) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-benzyl-3-(cyclopropylmethyl)purino[7,8-a]pyridine-2,4-dione.
| Compound Name | 1-benzyl-3-(cyclopropylmethyl)purino[7,8-a]pyridine-2,4-dione |
|---|---|
| PubChem CID | 10472803 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-benzyl-3-(cyclopropylmethyl)purino[7,8-a]pyridine-2,4-dione |
| SMILES | O=c1c2c(nc3ccccn32)n(Cc2ccccc2)c(=O)n1CC1CC1 |
| InChI | InChI=1S/C20H18N4O2/c25-19-17-18(21-16-8-4-5-11-22(16)17)23(12-14-6-2-1-3-7-14)20(26)24(19)13-15-9-10-15/h1-8,11,15H,9-10,12-13H2 |
| InChIKey | SGNCTBLOFLIZCK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |