C13H16N4O2 — CID 104729585
2-[1-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclopentyl]acetic acid (PubChem CID 104729585) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-[1-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclopentyl]acetic acid.
| Compound Name | 2-[1-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 104729585 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-[1-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(Nc2nccn3nccc23)CCCC1 |
| InChI | InChI=1S/C13H16N4O2/c18-11(19)9-13(4-1-2-5-13)16-12-10-3-6-15-17(10)8-7-14-12/h3,6-8H,1-2,4-5,9H2,(H,14,16)(H,18,19) |
| InChIKey | SEBHGYHMWQGWHI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |