C13H18N4O3 — CID 64702363
2-[1-[(3-carbamoylpyrazin-2-yl)amino]cyclohexyl]acetic acid (PubChem CID 64702363) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[1-[(3-carbamoylpyrazin-2-yl)amino]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[(3-carbamoylpyrazin-2-yl)amino]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 64702363 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[1-[(3-carbamoylpyrazin-2-yl)amino]cyclohexyl]acetic acid |
| SMILES | NC(=O)c1nccnc1NC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H18N4O3/c14-11(20)10-12(16-7-6-15-10)17-13(8-9(18)19)4-2-1-3-5-13/h6-7H,1-5,8H2,(H2,14,20)(H,16,17)(H,18,19) |
| InChIKey | LPTIJTYSAUSSCZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |