C15H20N4O2 — CID 104729773
2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]pent-4-enoic acid (PubChem CID 104729773) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]pent-4-enoic acid.
| Compound Name | 2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 104729773 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]pent-4-enoic acid |
| SMILES | C=CCC(Nc1nccn2nc(C(C)(C)C)cc12)C(=O)O |
| InChI | InChI=1S/C15H20N4O2/c1-5-6-10(14(20)21)17-13-11-9-12(15(2,3)4)18-19(11)8-7-16-13/h5,7-10H,1,6H2,2-4H3,(H,16,17)(H,20,21) |
| InChIKey | YQEOCHISIVPIPE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|