C16H23BrN4 — CID 104734126
4-[3-(2-bromoethyl)piperidin-1-yl]-2-propan-2-ylpyrazolo[1,5-a]pyrazine (PubChem CID 104734126) has the molecular formula C16H23BrN4 and a molecular weight of 351.29 g/mol. Its IUPAC name is 4-[3-(2-bromoethyl)piperidin-1-yl]-2-propan-2-ylpyrazolo[1,5-a]pyrazine.
| Compound Name | 4-[3-(2-bromoethyl)piperidin-1-yl]-2-propan-2-ylpyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 104734126 |
| Molecular Formula | C16H23BrN4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[3-(2-bromoethyl)piperidin-1-yl]-2-propan-2-ylpyrazolo[1,5-a]pyrazine |
| SMILES | CC(C)c1cc2c(N3CCCC(CCBr)C3)nccn2n1 |
| InChI | InChI=1S/C16H23BrN4/c1-12(2)14-10-15-16(18-7-9-21(15)19-14)20-8-3-4-13(11-20)5-6-17/h7,9-10,12-13H,3-6,8,11H2,1-2H3 |
| InChIKey | LECBZLXIIQTJTA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|