C11H18BrN3 — CID 80680560
3-(2-bromoethyl)-1-(1-methylimidazol-2-yl)piperidine (PubChem CID 80680560) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-(1-methylimidazol-2-yl)piperidine.
| Compound Name | 3-(2-bromoethyl)-1-(1-methylimidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 80680560 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-(2-bromoethyl)-1-(1-methylimidazol-2-yl)piperidine |
| SMILES | Cn1ccnc1N1CCCC(CCBr)C1 |
| InChI | InChI=1S/C11H18BrN3/c1-14-8-6-13-11(14)15-7-2-3-10(9-15)4-5-12/h6,8,10H,2-5,7,9H2,1H3 |
| InChIKey | ARHBMPYXIDTULO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|