C12H16ClN3O — CID 104734713
5-(5-chloropentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104734713) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 5-(5-chloropentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-(5-chloropentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 104734713 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-(5-chloropentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Cc1cc2c(=O)n(CCCCCCl)ccn2n1 |
| InChI | InChI=1S/C12H16ClN3O/c1-10-9-11-12(17)15(6-4-2-3-5-13)7-8-16(11)14-10/h7-9H,2-6H2,1H3 |
| InChIKey | VEYYCWULJYUFBI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|