C10H12N6O — CID 104735171
5-(3-azidopropyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104735171) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 5-(3-azidopropyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-(3-azidopropyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 104735171 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-(3-azidopropyl)-2-methylpyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Cc1cc2c(=O)n(CCCN=[N+]=[N-])ccn2n1 |
| InChI | InChI=1S/C10H12N6O/c1-8-7-9-10(17)15(4-2-3-12-14-11)5-6-16(9)13-8/h5-7H,2-4H2,1H3 |
| InChIKey | WXKUPHDMUFGWPH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|