C14H13BrN4O — CID 103350211
5-[(3-amino-5-bromophenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one (PubChem CID 103350211) has the molecular formula C14H13BrN4O and a molecular weight of 333.19 g/mol. Its IUPAC name is 5-[(3-amino-5-bromophenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-[(3-amino-5-bromophenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 103350211 |
| Molecular Formula | C14H13BrN4O |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-[(3-amino-5-bromophenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Cc1cc2c(=O)n(Cc3cc(N)cc(Br)c3)ccn2n1 |
| InChI | InChI=1S/C14H13BrN4O/c1-9-4-13-14(20)18(2-3-19(13)17-9)8-10-5-11(15)7-12(16)6-10/h2-7H,8,16H2,1H3 |
| InChIKey | YDEKOUHGYWVMFC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|