About 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one
5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104735002) has the molecular formula C11H11N5OS
and a molecular weight of 261.31 g/mol. Its IUPAC name is 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 104735002 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Cc1cc2c(=O)n(Cc3csc(N)n3)ccn2n1 |
| InChI | InChI=1S/C11H11N5OS/c1-7-4-9-10(17)15(2-3-16(9)14-7)5-8-6-18-11(12)13-8/h2-4,6H,5H2,1H3,(H2,12,13) |
| InChIKey | PRJNEGRNHLGCPK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one (CID 104735002) is 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one is Cc1cc2c(=O)n(Cc3csc(N)n3)ccn2n1.
What is the InChIKey of 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is PRJNEGRNHLGCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5OS/c1-7-4-9-10(17)15(2-3-16(9)14-7)5-8-6-18-11(12)13-8/h2-4,6H,5H2,1H3,(H2,12,13).
What are the key properties of 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one?
5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 261.31 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-amino-1,3-thiazol-4-yl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 104735002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).