C15H16N4O2 — CID 104734509
5-[(3-amino-5-methoxyphenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104734509) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-[(3-amino-5-methoxyphenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-[(3-amino-5-methoxyphenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 104734509 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-[(3-amino-5-methoxyphenyl)methyl]-2-methylpyrazolo[1,5-a]pyrazin-4-one |
| SMILES | COc1cc(N)cc(Cn2ccn3nc(C)cc3c2=O)c1 |
| InChI | InChI=1S/C15H16N4O2/c1-10-5-14-15(20)18(3-4-19(14)17-10)9-11-6-12(16)8-13(7-11)21-2/h3-8H,9,16H2,1-2H3 |
| InChIKey | IPSQVXLGKDZYSK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|