C19H16F3N3O — CID 10473617
1-isoquinolin-5-yl-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 10473617) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-isoquinolin-5-yl-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-isoquinolin-5-yl-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 10473617 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-isoquinolin-5-yl-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)Nc1cccc2cnccc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O/c1-12(13-5-7-15(8-6-13)19(20,21)22)24-18(26)25-17-4-2-3-14-11-23-10-9-16(14)17/h2-12H,1H3,(H2,24,25,26) |
| InChIKey | FIRXVLDQHKDDGB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |