C17H20N2 — CID 104736915
N-[[4-methyl-2-(pyridin-3-ylmethyl)phenyl]methyl]cyclopropanamine (PubChem CID 104736915) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[[4-methyl-2-(pyridin-3-ylmethyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-methyl-2-(pyridin-3-ylmethyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 104736915 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[[4-methyl-2-(pyridin-3-ylmethyl)phenyl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(CNC2CC2)c(Cc2cccnc2)c1 |
| InChI | InChI=1S/C17H20N2/c1-13-4-5-15(12-19-17-6-7-17)16(9-13)10-14-3-2-8-18-11-14/h2-5,8-9,11,17,19H,6-7,10,12H2,1H3 |
| InChIKey | CVVQBLQVONVOSP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |