C10H15FN2 — CID 104738943
N-[2-(3-fluoro-4-pyridinyl)ethyl]propan-2-amine (PubChem CID 104738943) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-pyridinyl)ethyl]propan-2-amine.
| Compound Name | N-[2-(3-fluoro-4-pyridinyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 104738943 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-[2-(3-fluoro-4-pyridinyl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1ccncc1F |
| InChI | InChI=1S/C10H15FN2/c1-8(2)13-6-4-9-3-5-12-7-10(9)11/h3,5,7-8,13H,4,6H2,1-2H3 |
| InChIKey | JBHGOJGNSGUWPN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |