C10H16FN3O2S — CID 107595222
N-(3-fluoro-4-pyridinyl)-2-(propan-2-ylamino)ethanesulfonamide (PubChem CID 107595222) has the molecular formula C10H16FN3O2S and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(3-fluoro-4-pyridinyl)-2-(propan-2-ylamino)ethanesulfonamide.
| Compound Name | N-(3-fluoro-4-pyridinyl)-2-(propan-2-ylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 107595222 |
| Molecular Formula | C10H16FN3O2S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-(3-fluoro-4-pyridinyl)-2-(propan-2-ylamino)ethanesulfonamide |
| SMILES | CC(C)NCCS(=O)(=O)Nc1ccncc1F |
| InChI | InChI=1S/C10H16FN3O2S/c1-8(2)13-5-6-17(15,16)14-10-3-4-12-7-9(10)11/h3-4,7-8,13H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | ORYSOMTWMXOLGH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |