C9H16N4O2S — CID 116787333
2-(propan-2-ylamino)-N-pyridazin-3-ylethanesulfonamide (PubChem CID 116787333) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-N-pyridazin-3-ylethanesulfonamide.
| Compound Name | 2-(propan-2-ylamino)-N-pyridazin-3-ylethanesulfonamide |
|---|---|
| PubChem CID | 116787333 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(propan-2-ylamino)-N-pyridazin-3-ylethanesulfonamide |
| SMILES | CC(C)NCCS(=O)(=O)Nc1cccnn1 |
| InChI | InChI=1S/C9H16N4O2S/c1-8(2)10-6-7-16(14,15)13-9-4-3-5-11-12-9/h3-5,8,10H,6-7H2,1-2H3,(H,12,13) |
| InChIKey | AAZZGEOGQNLJKN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |