C10H15N3O3 — CID 104741768
3-amino-N,N-bis(2-hydroxyethyl)pyridine-2-carboxamide (PubChem CID 104741768) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-hydroxyethyl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N,N-bis(2-hydroxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104741768 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-amino-N,N-bis(2-hydroxyethyl)pyridine-2-carboxamide |
| SMILES | Nc1cccnc1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H15N3O3/c11-8-2-1-3-12-9(8)10(16)13(4-6-14)5-7-15/h1-3,14-15H,4-7,11H2 |
| InChIKey | OACMILKGFGQCEZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |