C16H27N3O2 — CID 104741773
3-amino-N-heptyl-N-(3-hydroxypropyl)pyridine-2-carboxamide (PubChem CID 104741773) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-amino-N-heptyl-N-(3-hydroxypropyl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-heptyl-N-(3-hydroxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104741773 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-amino-N-heptyl-N-(3-hydroxypropyl)pyridine-2-carboxamide |
| SMILES | CCCCCCCN(CCCO)C(=O)c1ncccc1N |
| InChI | InChI=1S/C16H27N3O2/c1-2-3-4-5-6-11-19(12-8-13-20)16(21)15-14(17)9-7-10-18-15/h7,9-10,20H,2-6,8,11-13,17H2,1H3 |
| InChIKey | VDEXNBSHGPSAAN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|