C22H30N2O3 — CID 10474326
(7S,7aR,12bS)-10-(diethylaminomethyl)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 10474326) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (7S,7aR,12bS)-10-(diethylaminomethyl)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | (7S,7aR,12bS)-10-(diethylaminomethyl)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 10474326 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (7S,7aR,12bS)-10-(diethylaminomethyl)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | CCN(CC)Cc1cc2c3c(c1O)O[C@H]1[C@@H](O)C=CC4C(C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C22H30N2O3/c1-4-24(5-2)12-14-10-13-11-16-15-6-7-17(25)21-22(15,8-9-23(16)3)18(13)20(27-21)19(14)26/h6-7,10,15-17,21,25-26H,4-5,8-9,11-12H2,1-3H3/t15?,16?,17-,21-,22-/m0/s1 |
| InChIKey | RMCTZKCDYHCUGO-YJJLHGGGSA-N |
| XLogP | 2.04 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|