C23H23N3O3 — CID 135550822
(4R,4aR,7S,7aR,12bS)-3-methyl-10-phenyldiazenyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 135550822) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-methyl-10-phenyldiazenyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-methyl-10-phenyldiazenyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 135550822 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-methyl-10-phenyldiazenyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | CN1CC[C@]23c4c5cc(/N=N/c6ccccc6)c(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H23N3O3/c1-26-10-9-23-15-7-8-18(27)22(23)29-21-19(23)13(12-17(15)26)11-16(20(21)28)25-24-14-5-3-2-4-6-14/h2-8,11,15,17-18,22,27-28H,9-10,12H2,1H3/b25-24+/t15-,17+,18-,22-,23-/m0/s1 |
| InChIKey | BNADMDOUGPTRCZ-IMFGXDMOSA-N |
| XLogP | 3.61 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|