C15H30N2 — CID 104744777
1-cyclohexyl-N'-cyclopentyl-N'-ethylethane-1,2-diamine (PubChem CID 104744777) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 1-cyclohexyl-N'-cyclopentyl-N'-ethylethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 104744777 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 1-cyclohexyl-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CC(N)C1CCCCC1)C1CCCC1 |
| InChI | InChI=1S/C15H30N2/c1-2-17(14-10-6-7-11-14)12-15(16)13-8-4-3-5-9-13/h13-15H,2-12,16H2,1H3 |
| InChIKey | TVPURKTZJNQHMZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |