C11H22N2 — CID 63912333
N',1-dicyclopropyl-N'-propylethane-1,2-diamine (PubChem CID 63912333) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N',1-dicyclopropyl-N'-propylethane-1,2-diamine.
| Compound Name | N',1-dicyclopropyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 63912333 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N',1-dicyclopropyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CC(N)C1CC1)C1CC1 |
| InChI | InChI=1S/C11H22N2/c1-2-7-13(10-5-6-10)8-11(12)9-3-4-9/h9-11H,2-8,12H2,1H3 |
| InChIKey | HETOKCGOXSHUIL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |