C10H22N2 — CID 103934535
(2R)-1-N-butyl-1-N-cyclopropylpropane-1,2-diamine (PubChem CID 103934535) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (2R)-1-N-butyl-1-N-cyclopropylpropane-1,2-diamine.
| Compound Name | (2R)-1-N-butyl-1-N-cyclopropylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103934535 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2R)-1-N-butyl-1-N-cyclopropylpropane-1,2-diamine |
| SMILES | CCCCN(C[C@@H](C)N)C1CC1 |
| InChI | InChI=1S/C10H22N2/c1-3-4-7-12(8-9(2)11)10-5-6-10/h9-10H,3-8,11H2,1-2H3/t9-/m1/s1 |
| InChIKey | BHPHTEVQGKBTJH-SECBINFHSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |