C14H23N3O2 — CID 104747580
1-[2-cyclopentyl-2-(ethylamino)ethyl]-4-methylpyrazine-2,3-dione (PubChem CID 104747580) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[2-cyclopentyl-2-(ethylamino)ethyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[2-cyclopentyl-2-(ethylamino)ethyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 104747580 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-[2-cyclopentyl-2-(ethylamino)ethyl]-4-methylpyrazine-2,3-dione |
| SMILES | CCNC(Cn1ccn(C)c(=O)c1=O)C1CCCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-3-15-12(11-6-4-5-7-11)10-17-9-8-16(2)13(18)14(17)19/h8-9,11-12,15H,3-7,10H2,1-2H3 |
| InChIKey | FIWUMDVQQDMVKU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|